CAS 845885-87-2

4-(1,4-diazepan-1-yl)furo[3,2-c]pyridine

Description:

4-(1,4-diazepan-1-yl)furo[3,2-c]pyridine, with the CAS number 845885-87-2, is a heterocyclic compound characterized by the presence of both a furo[3,2-c]pyridine core and a diazepane moiety. This compound features a fused ring system that incorporates nitrogen atoms, contributing to its potential biological activity. The diazepane ring, a seven-membered cyclic amine, enhances the compound's ability to interact with biological targets, potentially influencing its pharmacological properties. The furo[3,2-c]pyridine structure is known for its role in various medicinal chemistry applications, often exhibiting properties such as anti-inflammatory, antimicrobial, or anticancer activities. The presence of nitrogen atoms in both the diazepane and pyridine rings can also affect the compound's solubility, stability, and reactivity. Overall, this compound's unique structural features make it a subject of interest in drug discovery and development, particularly in the search for new therapeutic agents. Further studies would be necessary to elucidate its specific biological activities and potential applications.

Formula: C₁₂H₁₅N₃O

InChI: InChI=1/C12H15N3O/c1-4-13-6-8-15(7-1)12-10-3-9-16-11(10)2-5-14-12/h2-3,5,9,13H,1,4,6-8H2

InChI key: InChIKey=JGVLLHBTSVQMHS-UHFFFAOYSA-N

SMILES: C1CNCCN(C1)c1c2ccoc2ccn1

Synonyms:

• 4-[1,4]Diazepan-1-yl-furo[3,2-c]pyridine

1-(Furo[3,2-c]pyridin-4-yl)homopiperazine

CAS: 845885-87-2

1-(Furo[3,2-c]pyridin-4-yl)homopiperazine

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 217.27g/mol

Ref: 54-OR14500