CAS 845885-90-7

4-Fluoro-3-formylbenzoic acid

Description:

4-Fluoro-3-formylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a formyl group (-CHO) and a fluorine atom attached to a benzene ring. The molecular structure features a carboxylic acid functional group (-COOH) and a formyl group, which contribute to its reactivity and potential applications in organic synthesis. The fluorine substituent can influence the compound's electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its unique functional groups allow it to participate in diverse chemical transformations, making it valuable in the synthesis of pharmaceuticals, agrochemicals, and other organic materials. Additionally, the presence of the fluorine atom can enhance the compound's biological activity and stability, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₈H₅FO₃

InChI: InChI=1/C8H5FO3/c9-7-2-1-5(8(11)12)3-6(7)4-10/h1-4H,(H,11,12)

SMILES: c1cc(c(cc1C(=O)O)C=O)F

Synonyms:

• 4-Fluoro-3-Formyl-Benzoic Acid
• Benzoic Acid, 4-Fluoro-3-Formyl-

4-Fluoro-3-formylbenzoic acid

CAS: 845885-90-7

Formula: C₈H₅FO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.1219

Ref: IN-DA0036F1

4-Fluoro-3-formylbenzoic acid

CAS: 845885-90-7

4-Fluoro-3-formylbenzoic acid

Purity: 97%

Color and Shape: Off-White Solid

Molecular weight: 168.12g/mol

Ref: 54-PC501645

4-Fluoro-3-formylbenzoic acid

CAS: 845885-90-7

Formula: C₈H₅FO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.123

Ref: 10-F093121

4-fluoro-3-formylbenzoic Acid

CAS: 845885-90-7

4-fluoro-3-formylbenzoic Acid is a byproduct of the catalytic conversion of dimethyl 4-nitrophenyl phosphate with Pd and H2O to form 2,4-dinitrophenol. It has been shown to be a modulator of nerve agents and frameworks. 4-Fluoro-3-formylbenzoic Acid is also used as a catalyst in the synthesis of nanoparticles. It has a half life of 1.6 hours and is hydrothermal in nature.

Formula: C₈H₅FO₃

Purity: Min. 95%

Molecular weight: 168.12 g/mol

Ref: 3D-FF104795