CAS 84592-35-8

di-tert-butyl 1-(tert-butylthio)-1,2-hy-drazinedicarboxylate

Description:

Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate, with CAS number 84592-35-8, is a chemical compound characterized by its unique structure that includes hydrazine and carboxylate functional groups. This compound typically appears as a viscous liquid or solid, depending on temperature and purity. It is known for its potential applications in organic synthesis and as a reagent in various chemical reactions. The presence of tert-butyl groups contributes to its steric hindrance, which can influence its reactivity and stability. Additionally, the thiol group in the structure may impart specific chemical properties, such as the ability to participate in nucleophilic reactions. Safety considerations are important when handling this compound, as it may pose health risks if inhaled or ingested. Proper storage conditions, including protection from moisture and light, are essential to maintain its integrity. Overall, di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate is a notable compound in the realm of synthetic organic chemistry.

Formula: C₁₄H₂₈N₂O₄S

InChI: InChI=1/C14H28N2O4S/c1-12(2,3)19-10(17)15-16(21-14(7,8)9)11(18)20-13(4,5)6/h1-9H3,(H,15,17)

SMILES: CC(C)(C)OC(=NN(C(=O)OC(C)(C)C)SC(C)(C)C)O

Synonyms:

• Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate
• Di-Tert-Butyl 1-(Tert-Butylsulfanyl)Hydrazine-1,2-Dicarboxylate

Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate

CAS: 84592-35-8

Formula: C₁₄H₂₈N₂O₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 320.4481

Ref: IN-DA003658

Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate

CAS: 84592-35-8

Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate is a fine chemical that is used as a research chemical and a speciality chemical. It is an intermediate for the synthesis of complex compounds with high quality and good performance. Di-tert-butyl 1-(tert-butylthio)-1,2-hydrazinedicarboxylate can be used to synthesize high purity hydrocarbons.

Formula: C₁₄H₂₈N₂O₄S

Purity: Min. 90 Area-%

Color and Shape: White Off-White Powder

Molecular weight: 320.45 g/mol

Ref: 3D-FD171559