CAS 84596-30-5

6-methyl-5-phenylpyridin-2-amine

Description:

6-Methyl-5-phenylpyridin-2-amine, with the CAS number 84596-30-5, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl group and a phenyl group attached to the pyridine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the amino group (-NH2) makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₂H₁₂N₂

InChI: InChI=1/C12H12N2/c1-9-11(7-8-12(13)14-9)10-5-3-2-4-6-10/h2-8H,1H3,(H2,13,14)

SMILES: Cc1c(ccc(=N)[nH]1)c1ccccc1

Synonyms:

• 2-Pyridinamine, 6-Methyl-5-Phenyl-
• 6-Methyl-5-phenylpyridin-2-amine

6-Methyl-5-phenylpyridin-2-amine

CAS: 84596-30-5

Versatile small molecule scaffold

Formula: C₁₂H₁₂N₂

Purity: Min. 95%

Molecular weight: 184.24 g/mol

Ref: 3D-JDA59630