CAS 846021-26-9

2-amino-6-methylpyridine-3-carboxylic acid

Description:

2-Amino-6-methylpyridine-3-carboxylic acid, also known by its CAS number 846021-26-9, is an organic compound characterized by its pyridine ring structure, which features an amino group and a carboxylic acid functional group. This compound typically exhibits properties associated with both basic and acidic functionalities due to the presence of the amino and carboxylic acid groups, respectively. It is a polar molecule, which enhances its solubility in water and other polar solvents. The methyl group at the 6-position of the pyridine ring contributes to its hydrophobic character, influencing its interactions in biological systems. This compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it of interest in synthetic organic chemistry. Additionally, its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a biochemical probe, although specific applications would depend on further research into its biological activity and reactivity.

Formula: C₇H₈N₂O₂

InChI: InChI=1/C7H8N2O2/c1-4-2-3-5(7(10)11)6(8)9-4/h2-3H,1H3,(H2,8,9)(H,10,11)

SMILES: Cc1ccc(c(N)n1)C(=O)O

Synonyms:

• 2-Amino-6-methylnicotinic acid
• 3-Pyridinecarboxylic Acid, 2-Amino-6-Methyl-

2-Amino-6-methylnicotinic acid

CAS: 846021-26-9

Formula: C₇H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 152.1506

Ref: IN-DA004QAK

2-Amino-6-methylnicotinic acid

CAS: 846021-26-9

2-Amino-6-methylnicotinic acid

Purity: 97%

Molecular weight: 152.15g/mol

Ref: 54-OR90378

2-Amino-6-methyl-3-pyridinecarboxylic acid

CAS: 846021-26-9

Formula: C₇H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 152.153

Ref: 10-F331122