CymitQuimica logo

CAS 846023-56-1

:

2-Cyano-N-(2,4-dichloro-5-methoxyphenyl)-3-[[4-methoxy-3-[3-(4-methyl-1-piperazinyl)propoxy]phenyl]amino]-2-propenamide

Description:
2-Cyano-N-(2,4-dichloro-5-methoxyphenyl)-3-[[4-methoxy-3-[3-(4-methyl-1-piperazinyl)propoxy]phenyl]amino]-2-propenamide, with CAS number 846023-56-1, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as cyano, amide, and methoxy. This compound features a propenamide backbone, which contributes to its potential reactivity and biological activity. The presence of dichloro and methoxy substituents on the phenyl rings enhances its lipophilicity and may influence its pharmacokinetic properties. Additionally, the incorporation of a piperazine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the molecular interactions dictated by its structure. Overall, this compound exemplifies the complexity often found in drug-like molecules, which can lead to diverse biological activities.
Formula:C26H31Cl2N5O4
InChI:InChI=1S/C26H31Cl2N5O4/c1-32-8-10-33(11-9-32)7-4-12-37-25-13-19(5-6-23(25)35-2)30-17-18(16-29)26(34)31-22-15-24(36-3)21(28)14-20(22)27/h5-6,13-15,17,30H,4,7-12H2,1-3H3,(H,31,34)
InChI key:InChIKey=ASDUFQREKMWHMM-UHFFFAOYSA-N
SMILES:O(CCCN1CCN(C)CC1)C2=C(OC)C=CC(NC=C(C(NC3=CC(OC)=C(Cl)C=C3Cl)=O)C#N)=C2
Synonyms:
  • 2-Propenamide, 2-cyano-N-(2,4-dichloro-5-methoxyphenyl)-3-[[4-methoxy-3-[3-(4-methyl-1-piperazinyl)propoxy]phenyl]amino]-
  • 2-Cyano-N-(2,4-dichloro-5-methoxyphenyl)-3-[[4-methoxy-3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]amino]acrylamide
  • 2-Cyano-N-(2,4-dichloro-5-methoxyphenyl)-3-[[4-methoxy-3-[3-(4-methyl-1-piperazinyl)propoxy]phenyl]amino]-2-propenamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.