
CAS 84604-29-5
:3-Amino-2-pyridinebutanenitrile
Description:
3-Amino-2-pyridinebutanenitrile, identified by its CAS number 84604-29-5, is an organic compound featuring a pyridine ring and a nitrile functional group. This substance is characterized by the presence of an amino group, which contributes to its potential as a building block in pharmaceutical and chemical synthesis. The molecular structure includes a pyridine moiety, which is a six-membered aromatic ring containing one nitrogen atom, and a butanenitrile chain, indicating the presence of a four-carbon chain terminated by a nitrile group (-C≡N). The compound is likely to exhibit polar characteristics due to the amino and nitrile groups, influencing its solubility in polar solvents. Additionally, the presence of the amino group suggests potential for hydrogen bonding, which can affect its reactivity and interaction with other molecules. Overall, 3-Amino-2-pyridinebutanenitrile may serve as an important intermediate in the synthesis of various bioactive compounds or materials in medicinal chemistry.
Formula:C9H11N3
InChI:InChI=1S/C9H11N3/c10-6-2-1-5-9-8(11)4-3-7-12-9/h3-4,7H,1-2,5,11H2
InChI key:InChIKey=DYBCZGAECZNGOJ-UHFFFAOYSA-N
SMILES:C(CCC#N)C1=C(N)C=CC=N1
Synonyms:- 2-Pyridinebutanenitrile, 3-amino-
- 3-Amino-2-(3-cyanopropyl)pyridine
- 3-Amino-2-pyridinebutanenitrile
- 3-Aminopyridine-2-butyronitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.