CAS 84604-38-6

1-(3,3,5-Trimethylcyclohexyl)-1-propanone

Description:

1-(3,3,5-Trimethylcyclohexyl)-1-propanone, with the CAS number 84604-38-6, is an organic compound characterized by its ketone functional group, which is indicative of its reactivity and properties. This substance features a propanone backbone substituted with a bulky 3,3,5-trimethylcyclohexyl group, contributing to its unique steric and electronic characteristics. Typically, compounds of this nature exhibit moderate volatility and may have a relatively high boiling point due to the presence of the cyclohexyl ring, which can influence intermolecular interactions. The presence of the bulky substituent can also affect the compound's solubility in various solvents, often making it less soluble in polar solvents. Additionally, this compound may be utilized in organic synthesis and as an intermediate in the production of other chemical entities. Safety data should be consulted for handling and storage, as ketones can pose health risks if inhaled or ingested. Overall, 1-(3,3,5-Trimethylcyclohexyl)-1-propanone is a notable compound in the field of organic chemistry with potential applications in various chemical processes.

Formula: C₁₂H₂₂O

InChI: InChI=1S/C12H22O/c1-5-11(13)10-6-9(2)7-12(3,4)8-10/h9-10H,5-8H2,1-4H3

InChI key: InChIKey=AQNZBQGJMZUXQX-UHFFFAOYSA-N

SMILES: C(CC)(=O)C1CC(C)(C)CC(C)C1

Synonyms:

• 1-(3,3,5-Trimethylcyclohexyl)-1-propanone
• 1-Propanone, 1-(3,3,5-trimethylcyclohexyl)-