
CAS 84604-55-7
:4-[4-(Formyloxy)phenyl]-2-butanone
Description:
4-[4-(Formyloxy)phenyl]-2-butanone, with the CAS number 84604-55-7, is an organic compound characterized by its structure, which includes a butanone moiety and a formyloxy group attached to a phenyl ring. This compound typically exhibits properties associated with aromatic ketones, such as moderate volatility and solubility in organic solvents. The presence of the formyloxy group suggests potential reactivity, particularly in nucleophilic substitution reactions or as a precursor in synthetic organic chemistry. Its molecular structure may confer specific optical properties, making it of interest in fields such as materials science or pharmaceuticals. Additionally, compounds with similar structures often demonstrate biological activity, which could warrant further investigation into its potential applications. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken due to potential hazards associated with organic compounds.
Formula:C11H12O3
InChI:InChI=1S/C11H12O3/c1-9(13)2-3-10-4-6-11(7-5-10)14-8-12/h4-8H,2-3H2,1H3
InChI key:InChIKey=ZZFMJIBHZZTLPK-UHFFFAOYSA-N
SMILES:C(CC(C)=O)C1=CC=C(OC=O)C=C1
Synonyms:- Raspberry ketone formate
- 4-[4-(Formyloxy)phenyl]-2-butanone
- 2-Butanone, 4-[4-(formyloxy)phenyl]-
- [4-(3-Oxobutyl)phenyl] formate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.