CAS 84604-67-1
:1,3-Diethyl-2-fluorobenzene
Description:
1,3-Diethyl-2-fluorobenzene is an aromatic compound characterized by a benzene ring substituted with two ethyl groups and one fluorine atom. The presence of the fluorine atom introduces unique properties, such as increased electronegativity and potential for enhanced reactivity compared to its non-fluorinated counterparts. This compound typically exhibits a non-polar character due to the symmetrical distribution of its substituents, which can influence its solubility in various solvents. Its boiling and melting points are generally higher than those of similar hydrocarbons due to the presence of the fluorine atom, which can engage in dipole-dipole interactions. Additionally, 1,3-Diethyl-2-fluorobenzene may be utilized in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C10H13F
InChI:InChI=1/C10H13F/c1-3-8-6-5-7-9(4-2)10(8)11/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=BJINCTYPVIJQPO-UHFFFAOYSA-N
SMILES:C(C)C1=C(F)C(CC)=CC=C1
Synonyms:- Benzene, 1,3-diethyl-2-fluoro-
- 1,3-Diethyl-2-fluorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.