
CAS 84605-13-0
:2-[2-[2-(Tetradecyloxy)ethoxy]ethoxy]ethyl dodecanoate
Description:
2-[2-[2-(Tetradecyloxy)ethoxy]ethoxy]ethyl dodecanoate, with CAS number 84605-13-0, is a synthetic chemical compound characterized by its long hydrophobic hydrocarbon chains and ether linkages. This compound features a dodecanoate (laurate) ester group, which contributes to its surfactant properties, making it useful in various applications such as emulsifiers and solubilizers in formulations. The presence of the tetradecyloxy group enhances its hydrophobic characteristics, allowing it to interact effectively with lipid membranes. Its structure suggests that it may exhibit amphiphilic behavior, with both hydrophilic and hydrophobic regions, which is typical for surfactants. This compound is likely to be soluble in organic solvents while having limited solubility in water, which is a common trait for long-chain fatty acid esters. Additionally, due to its complex structure, it may possess unique thermal and chemical stability, making it suitable for use in various industrial and cosmetic applications. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential risks.
Formula:C32H64O5
InChI:InChI=1S/C32H64O5/c1-3-5-7-9-11-13-14-15-17-19-21-23-25-34-26-27-35-28-29-36-30-31-37-32(33)24-22-20-18-16-12-10-8-6-4-2/h3-31H2,1-2H3
InChI key:InChIKey=LLMYKCFFGJIPLB-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCCCCCCCCCCCCC)(CCCCCCCCCCC)=O
Synonyms:- Dodecanoic acid, 2-[2-[2-(tetradecyloxy)ethoxy]ethoxy]ethyl ester
- 2-[2-[2-(Tetradecyloxy)ethoxy]ethoxy]ethyl dodecanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dodecanoic acid,2-[2-[2-(tetradecyloxy)ethoxy]ethoxy]ethyl ester
CAS:Formula:C32H64O5Molecular weight:528.8476
