CAS 846052-89-9
:benzyl 2,2-dimethylpiperazine-1-carboxylate
Description:
Benzyl 2,2-dimethylpiperazine-1-carboxylate is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzyl group and a carboxylate functional group, contributing to its solubility and reactivity. It typically appears as a white to off-white solid or a viscous liquid, depending on its purity and environmental conditions. The presence of the dimethyl substituents on the piperazine ring enhances its steric properties, potentially influencing its biological activity and interactions. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential applications in synthesizing other chemical entities or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H20N2O2
InChI:InChI=1/C14H20N2O2/c1-14(2)11-15-8-9-16(14)13(17)18-10-12-6-4-3-5-7-12/h3-7,15H,8-11H2,1-2H3
SMILES:CC1(C)CNCCN1C(=O)OCc1ccccc1
Synonyms:- Benzyl-2,2-dimethylpiperazin-1-carboxylat
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
