CAS 84609-13-2

2-Butenoic acid, 4-(1,3-benzodioxol-5-yl)-4-oxo-, (E)-

Description:

2-Butenoic acid, 4-(1,3-benzodioxol-5-yl)-4-oxo-, (E)-, also known by its CAS number 84609-13-2, is an organic compound characterized by its unique structural features. This compound contains a butenoic acid moiety, which is a four-carbon unsaturated carboxylic acid, and a benzodioxole group, which contributes to its aromatic properties. The (E)- designation indicates that the compound has a specific geometric configuration around the double bond, with substituents on opposite sides, which can influence its reactivity and interactions. The presence of the carbonyl group (oxo) enhances its potential for various chemical reactions, including condensation and addition reactions. This compound may exhibit biological activity due to its structural components, making it of interest in medicinal chemistry and organic synthesis. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, which are important considerations for its practical applications. Overall, 2-Butenoic acid, 4-(1,3-benzodioxol-5-yl)-4-oxo-, (E)- is a compound with diverse chemical characteristics that can be explored for various scientific and industrial applications.

Formula: C₁₁H₈O₅

InChI: InChI=1/C11H8O5/c12-8(2-4-11(13)14)7-1-3-9-10(5-7)16-6-15-9/h1-5H,6H2,(H,13,14)/b4-2+

Synonyms:

• (E)-4-(Benzo[d][1,3]dioxol-5-yl)-4-oxobut-2-enoic Acid
• 2-Butenoic acid, 4-(1,3-benzodioxol-5-yl)-4-oxo-, (E)-

(E)-4-(Benzo[d][1,3]dioxol-5-yl)-4-oxobut-2-enoic acid

CAS: 84609-13-2

(E)-4-(Benzo[d][1,3]dioxol-5-yl)-4-oxobut-2-enoic acid

Purity: 98%

Molecular weight: 220.18g/mol

Ref: 54-OR1067901