CAS 84633-28-3
:Eurycomanol
Description:
Eurycomanol is a natural compound primarily derived from the roots of the plant Eurycoma longifolia, commonly known as Tongkat Ali. It belongs to the class of quassinoids, which are known for their diverse biological activities. Eurycomanol is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its pharmacological properties. This compound has garnered attention for its potential health benefits, including its use as an aphrodisiac, anti-inflammatory agent, and adaptogen. Research suggests that Eurycomanol may enhance testosterone levels, improve sexual health, and support overall vitality. Additionally, it exhibits antioxidant properties, which can help combat oxidative stress in the body. The compound's safety profile and efficacy are still under investigation, and while it is generally considered safe in moderate amounts, further studies are needed to fully understand its therapeutic potential and mechanisms of action. As with any herbal supplement, it is advisable to consult healthcare professionals before use, especially for individuals with underlying health conditions or those taking other medications.
Formula:C20H26O9
InChI:InChI=1S/C20H26O9/c1-7-4-10(21)13(23)17(3)9(7)5-11-18-6-28-20(27,16(17)18)12(22)8(2)19(18,26)14(24)15(25)29-11/h4,9-14,16,21-24,26-27H,2,5-6H2,1,3H3/t9-,10-,11+,12+,13+,14-,16+,17+,18+,19-,20-/m0/s1
InChI key:InChIKey=QPHFGJSVJHRLFM-KKSWBDSZSA-N
SMILES:O[C@]12[C@@]34[C@@]([C@]5(C)[C@@](C[C@]3(OC(=O)[C@@H]1O)[H])(C(C)=C[C@H](O)[C@H]5O)[H])([C@@](O)(OC4)[C@H](O)C2=C)[H]
Synonyms:- Eurycomanol
- (1β,2α,11β,12α,15β)-11,20-Epoxy-1,2,11,12,14,15-hexahydroxypicrasa-3,13(21)-dien-16-one
- 5H-1,11c-(Epoxymethano)phenanthro[10,1-bc]pyran, picrasa-3,13(21)-dien-16-one deriv.
- Picrasa-3,13(21)-dien-16-one, 11,20-epoxy-1,2,11,12,14,15-hexahydroxy-, (1β,2α,11β,12α,15β)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Eurycomanol
CAS:<p>Eurycomanol is a potent anticancer compound that has been extensively studied for its medicinal properties. It is an analog of the Chinese herb Tongkat Ali, which has traditionally been used to treat a variety of ailments. Eurycomanol works by inhibiting specific kinases and proteins that are involved in cancer cell growth and proliferation. This inhibition leads to apoptosis, or programmed cell death, in tumor cells. Eurycomanol has been shown to be effective against a range of human cancers and cancer cell lines, making it a promising candidate for future cancer treatments. Additionally, eurycomanol can be detected in urine samples, making it a potential biomarker for cancer diagnosis and monitoring.</p>Formula:C20H26O9Purity:Min. 95%Molecular weight:410.4 g/mol
