
CAS 84633-33-0
:Asparanin A
Description:
Asparanin A, with the CAS number 84633-33-0, is a naturally occurring compound classified as a secondary metabolite. It is primarily derived from certain species of fungi and has garnered interest due to its potential biological activities. Characteristically, Asparanin A exhibits a complex molecular structure that includes multiple functional groups, contributing to its reactivity and interaction with biological systems. It is known for its potential antimicrobial and antifungal properties, making it a subject of research in pharmacology and natural product chemistry. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in various fields, including medicine and agriculture. Additionally, Asparanin A may play a role in plant defense mechanisms, highlighting its ecological significance. Ongoing studies aim to further elucidate its mechanisms of action and potential therapeutic applications, particularly in the development of new antimicrobial agents.
Formula:C39H64O13
InChI:InChI=1S/C39H64O13/c1-18-7-12-39(47-17-18)19(2)28-25(52-39)14-24-22-6-5-20-13-21(8-10-37(20,3)23(22)9-11-38(24,28)4)48-36-34(32(45)30(43)27(16-41)50-36)51-35-33(46)31(44)29(42)26(15-40)49-35/h18-36,40-46H,5-17H2,1-4H3/t18-,19-,20+,21-,22+,23-,24-,25-,26+,27+,28-,29+,30+,31-,32-,33+,34+,35-,36+,37-,38-,39+/m0/s1
InChI key:InChIKey=MMTWXUQMLQGAPC-XIBAMJMMSA-N
SMILES:C[C@@]12[C@@]3([C@](C[C@]1([C@]4([C@](CC2)([C@]5(C)[C@](CC4)(C[C@@H](O[C@H]6[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@@H](O)[C@H](O)[C@@H](CO)O6)CC5)[H])[H])[H])[H])(O[C@@]8([C@H]3C)CC[C@H](C)CO8)[H])[H]
Synonyms:- Asparinin A
- (3β,5β,25S)-Spirostan-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
- Asparanin A
- Schidigera saponin D5
- β-D-Glucopyranoside, (3β,5β,25S)-spirostan-3-yl 2-O-β-D-glucopyranosyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Asparanin A
CAS:<p>Asparanin A, an apoptosis inducer with anticancer properties, arrests the cell cycle in the G0/G1 phase via the mitochondria and PI3K/AKT signaling pathways.</p>Formula:C39H64O13Purity:98%Color and Shape:SolidMolecular weight:740.92Asparanin A
CAS:Asparanin A is a steroidal saponin, which is a bioactive compound isolated from the roots of Asparagus species. It exhibits its mode of action by interfering with cellular growth and inducing apoptosis in cancer cells, primarily through the modulation of signaling pathways such as the mitochondrial apoptotic pathway. This involves the regulation of various proteins that are crucial for cell survival and death.Formula:C39H64O13Purity:Min. 95%Molecular weight:740.92 g/mol



