CAS 84633-34-1
:Shatavarin IV
Description:
Shatavarin IV is a glycoside derived from the plant Asparagus racemosus, commonly known as Shatavari, which is traditionally used in Ayurvedic medicine. It is known for its potential health benefits, particularly in supporting female reproductive health and hormonal balance. The compound is characterized by its complex structure, which includes multiple sugar moieties attached to a steroid backbone, contributing to its bioactivity. Shatavarin IV exhibits antioxidant properties and may have adaptogenic effects, helping the body to cope with stress. Additionally, it has been studied for its potential role in enhancing fertility and lactation, as well as its immunomodulatory effects. The substance is typically extracted from the roots of the plant and is often used in herbal formulations. Its safety profile is generally considered favorable, although further research is necessary to fully understand its pharmacological effects and mechanisms of action. As with any herbal supplement, it is advisable to consult a healthcare professional before use, especially for individuals with underlying health conditions or those taking other medications.
Formula:C45H74O17
InChI:InChI=1S/C45H74O17/c1-19-8-13-45(55-18-19)20(2)30-27(62-45)15-26-24-7-6-22-14-23(9-11-43(22,4)25(24)10-12-44(26,30)5)57-42-39(61-41-36(53)34(51)32(49)28(16-46)58-41)37(54)38(29(17-47)59-42)60-40-35(52)33(50)31(48)21(3)56-40/h19-42,46-54H,6-18H2,1-5H3/t19-,20-,21-,22+,23-,24+,25-,26-,27-,28+,29+,30-,31-,32+,33+,34-,35+,36+,37-,38+,39+,40-,41-,42+,43-,44-,45+/m0/s1
InChI key:InChIKey=BCUDKRWNGQAFLF-PJFZGHSASA-N
SMILES:C[C@@]12[C@@]3([C@](C[C@]1([C@]4([C@](CC2)([C@]5(C)[C@](CC4)(C[C@@H](O[C@H]6[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@@H](O)[C@H](O[C@H]8[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O8)[C@@H](CO)O6)CC5)[H])[H])[H])[H])(O[C@@]9([C@H]3C)CC[C@H](C)CO9)[H])[H]
Synonyms:- Asparanin B
- (3β,5β,25S)-Spirostan-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-[β-D-glucopyranosyl-(1→2)]-β-D-glucopyranoside
- Curillin H
- β-D-Glucopyranoside, (3β,5β,25S)-spirostan-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-[β-D-glucopyranosyl-(1→2)]-
- Shatavarin IV
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Asparanin B
CAS:Formula:C45H74O17Purity:≥ 90.0%Color and Shape:White to off-white or pale beige powder or crystalsMolecular weight:887.06Shatavarin IV
CAS:Shatavarin IV exhibits anti-malassezia and anticancer properties in vitro and in vivo.Formula:C45H74O17Purity:98%Color and Shape:SolidMolecular weight:887.06Shatavarin iv
CAS:Natural glycosideFormula:C45H74O17Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:887.08Asparanin B
CAS:Asparanin B is a natural compound, which is a specialized saponin derived from the roots of asparagus plants, specifically from Asparagus officinalis. It exerts its effects through the modulation of cellular pathways, including the inhibition of cell proliferation, induction of apoptosis, and disruption of key signaling mechanisms involved in cancer development and progression. As a result, Asparanin B is being studied for its potential anticancer properties.
Formula:C45H74O17Purity:75%MinMolecular weight:887.1 g/mol




