CAS 84638-72-2

Methyl 7-hydroxy-1H-indole-2-carboxylate

Description:

Methyl 7-hydroxy-1H-indole-2-carboxylate, with the CAS number 84638-72-2, is an organic compound that belongs to the indole family, characterized by its indole core structure, which consists of a fused benzene and pyrrole ring. This compound features a carboxylate group and a hydroxyl group, contributing to its potential as a bioactive molecule. It is typically a white to off-white solid and is soluble in organic solvents, which makes it useful in various chemical reactions and applications. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its reactivity and interactions with other molecules. Methyl 7-hydroxy-1H-indole-2-carboxylate may also possess pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis often involves multi-step organic reactions, and it can serve as a precursor for the development of more complex indole derivatives. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₀H₉NO₃

InChI: InChI=1S/C10H9NO3/c1-14-10(13)7-5-6-3-2-4-8(12)9(6)11-7/h2-5,11-12H,1H3

InChI key: InChIKey=VQTQDVYIDANALW-UHFFFAOYSA-N

SMILES: OC1=C2C(C=C(C(OC)=O)N2)=CC=C1

Synonyms:

• Methyl 7-hydroxyindole-2-carboxylate
• Methyl 7-hydroxy-1H-indole-2-carboxylate
• 1H-Indole-2-carboxylic acid, 7-hydroxy-, methyl ester