CymitQuimica logo

CAS 84642-33-1

:

(2,5-dioxopyrrolidin-1-yl) 2-[[(2S)-2-(tert-butoxycarbonylamino)-3-methyl-butanoyl]amino]-4-methyl-pentanoate

Description:
The chemical substance known as (2,5-dioxopyrrolidin-1-yl) 2-[[(2S)-2-(tert-butoxycarbonylamino)-3-methyl-butanoyl]amino]-4-methyl-pentanoate, with the CAS number 84642-33-1, is a complex organic compound characterized by its multi-functional groups and structural features. It contains a pyrrolidine ring with two carbonyl groups, indicating the presence of a dioxo moiety, which contributes to its reactivity and potential applications in organic synthesis. The molecule also features a tert-butoxycarbonyl (Boc) protecting group, commonly used in peptide synthesis to protect amine functionalities. The presence of a branched-chain amino acid derivative suggests potential bioactivity, possibly in pharmaceutical contexts. Its structure indicates that it may exhibit specific stereochemical properties due to the chiral centers present, which can influence its biological interactions. Overall, this compound's unique combination of functional groups and stereochemistry makes it of interest in medicinal chemistry and related fields.
Formula:C20H33N3O7
InChI:InChI=1/C20H33N3O7/c1-11(2)10-13(18(27)30-23-14(24)8-9-15(23)25)21-17(26)16(12(3)4)22-19(28)29-20(5,6)7/h11-13,16H,8-10H2,1-7H3,(H,21,26)(H,22,28)/t13?,16-/m0/s1
SMILES:CC(C)CC(C(=O)ON1C(=O)CCC1=O)N=C([C@H](C(C)C)N=C(O)OC(C)(C)C)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.