CAS 84642-61-5
:1-Methyl-2-oxopropyl butanoate
Description:
1-Methyl-2-oxopropyl butanoate, with the CAS number 84642-61-5, is an organic compound that belongs to the class of esters. It is characterized by its ester functional group, which is formed from the reaction of an alcohol and a carboxylic acid. This compound typically exhibits a pleasant, fruity odor, making it useful in flavoring and fragrance applications. Its molecular structure includes a butanoate moiety, which contributes to its chemical properties and reactivity. The presence of the ketone group (2-oxopropyl) in the structure can influence its reactivity, particularly in nucleophilic addition reactions. 1-Methyl-2-oxopropyl butanoate is generally soluble in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. As with many organic compounds, it should be handled with care, observing appropriate safety protocols to mitigate any potential hazards associated with its use. Overall, this compound is of interest in various industrial applications, particularly in the synthesis of other chemical products.
Formula:C8H14O3
InChI:InChI=1S/C8H14O3/c1-4-5-8(10)11-7(3)6(2)9/h7H,4-5H2,1-3H3
InChI key:InChIKey=LJDWJXUIGKSETE-UHFFFAOYSA-N
SMILES:C(OC(C(C)=O)C)(CCC)=O
Synonyms:- (1-Methyl-2-oxo-propyl) butanoate
- 1-Methyl-2-oxopropyl butanoate
- 3-Oxobutan-2-Yl Butanoate
- Acetoin butyrate
- Acetoyl butyrate
- Butan-3-one-2-yl butanoate
- Butan-3-one-2-yl butanoate (natural)
- Butanoic acid, 1-methyl-2-oxopropyl ester
- FEMA No. 3332
- 1-Methyl-2-oxopropyl butyrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.