CAS 84642-64-8

β,γ,4-Trimethylcyclohexanepropanol

Description:

β,γ,4-Trimethylcyclohexanepropanol, with the CAS number 84642-64-8, is an organic compound characterized by its cyclohexane structure substituted with multiple methyl groups and a hydroxyl group. This compound features a cyclohexane ring that is further modified by the presence of a propanol group, which contributes to its alcohol functionality. The presence of three methyl groups enhances its hydrophobic characteristics and influences its physical properties, such as boiling point and solubility. Typically, compounds like this may exhibit moderate polarity due to the hydroxyl group, allowing for potential hydrogen bonding interactions. The structural complexity can lead to interesting reactivity patterns, making it relevant in various chemical applications, including as a potential intermediate in organic synthesis or in the formulation of specialty chemicals. Its specific characteristics, such as melting point, boiling point, and density, would depend on the precise molecular interactions and the arrangement of substituents around the cyclohexane ring.

Formula: C₁₂H₂₄O

InChI: InChI=1S/C12H24O/c1-9-4-6-12(7-5-9)11(3)10(2)8-13/h9-13H,4-8H2,1-3H3

InChI key: InChIKey=JADYNECLVZHQIE-UHFFFAOYSA-N

SMILES: C(C(CO)C)(C)C1CCC(C)CC1

Synonyms:

• β,γ,4-Trimethylcyclohexanepropanol
• Cyclohexanepropanol, β,γ,4-trimethyl-