CAS 846549-37-9
:1-azido-28-oxo-3,6,9,12,15,18,21,24,30-nonaoxa-27-azadotriacontan-32-oic acid
Description:
1-Azido-28-oxo-3,6,9,12,15,18,21,24,30-nonaoxa-27-azadotriacontan-32-oic acid is a complex organic compound characterized by its unique structural features, including multiple ether and amide linkages due to the presence of nine ether (oxa) groups and one azide (azido) functional group. The compound's long carbon chain contributes to its hydrophobic properties, while the azido group introduces potential for reactivity, particularly in click chemistry applications. The presence of the oxo group indicates a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit interesting biological activities due to its structural complexity and functional groups, making it a candidate for research in medicinal chemistry or materials science. Its CAS number, 846549-37-9, allows for easy identification in chemical databases, facilitating further exploration of its properties and potential applications. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential utility in various fields.
Formula:C22H42N4O12
InChI:InChI=1/C22H42N4O12/c23-26-25-2-4-31-6-8-33-10-12-35-14-16-37-18-17-36-15-13-34-11-9-32-7-5-30-3-1-24-21(27)19-38-20-22(28)29/h1-20H2,(H,24,27)(H,28,29)
SMILES:C(COCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[NH-])N=C(COCC(=O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
O-(2-Azidoethyl)-O-[2-(diglycolyl-amino)ethyl]heptaethylene glycol
CAS:Formula:C22H42N4O12Purity:97%Color and Shape:LiquidMolecular weight:554.58852-((Azido-PEG8-carbamoyl)methoxy)acetic acid
CAS:2-((Azido-PEG8-carbamoyl)methoxy)acetic acidPurity:97%Molecular weight:554.59g/mol2-((Azido-PEG8-carbamoyl)methoxy)acetic acid
CAS:2-((Azido-PEG8-carbamoyl)methoxy)acetic acid, a PEG-derived linker for PROTACs synthesis.Formula:C22H42N4O12Purity:98%Color and Shape:SolidMolecular weight:554.59O-(2-Azidoethyl)-O-[2-(diglycoly-amino)ethyl]heptaethylene glycol
CAS:O-(2-Azidoethyl)-O-[2-(diglycoly-amino)ethyl]heptaethylene glycol is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. O-(2-Azidoethyl)-O-[2-(diglycoly-amino)ethyl]heptaethylene glycol is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.Formula:C22H42N4O12Purity:Min. 95%Color and Shape:PowderMolecular weight:554.59 g/mol




