CymitQuimica logo

CAS 846549-37-9

:

1-azido-28-oxo-3,6,9,12,15,18,21,24,30-nonaoxa-27-azadotriacontan-32-oic acid

Description:
1-Azido-28-oxo-3,6,9,12,15,18,21,24,30-nonaoxa-27-azadotriacontan-32-oic acid is a complex organic compound characterized by its unique structural features, including multiple ether and amide linkages due to the presence of nine ether (oxa) groups and one azide (azido) functional group. The compound's long carbon chain contributes to its hydrophobic properties, while the azido group introduces potential for reactivity, particularly in click chemistry applications. The presence of the oxo group indicates a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit interesting biological activities due to its structural complexity and functional groups, making it a candidate for research in medicinal chemistry or materials science. Its CAS number, 846549-37-9, allows for easy identification in chemical databases, facilitating further exploration of its properties and potential applications. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential utility in various fields.
Formula:C22H42N4O12
InChI:InChI=1/C22H42N4O12/c23-26-25-2-4-31-6-8-33-10-12-35-14-16-37-18-17-36-15-13-34-11-9-32-7-5-30-3-1-24-21(27)19-38-20-22(28)29/h1-20H2,(H,24,27)(H,28,29)
InChI key:WWDNBBVPYDZICO-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[NH-])N=C(COCC(=O)O)O
Found 6 products.