CAS 846563-66-4
:4,4'-Bis[(1E)-2-[4-(hexyloxy)phenyl]ethenyl]-2,2'-bipyridine
Description:
4,4'-Bis[(1E)-2-[4-(hexyloxy)phenyl]ethenyl]-2,2'-bipyridine, identified by its CAS number 846563-66-4, is an organic compound characterized by its complex structure, which includes a bipyridine core and two hexyloxy-substituted phenyl groups connected via vinyl linkages. This compound exhibits properties typical of conjugated systems, such as extended π-conjugation, which can lead to interesting optical and electronic behaviors. It is likely to be soluble in organic solvents due to the presence of the hexyloxy groups, which enhance its hydrophobic character. The bipyridine moiety can participate in coordination chemistry, making it a potential ligand for metal complexes. Additionally, the compound may exhibit fluorescence or other photophysical properties, making it of interest in materials science, particularly in the development of organic light-emitting diodes (OLEDs) or sensors. Its synthesis and applications would typically involve organic synthesis techniques and characterization methods such as NMR, UV-Vis spectroscopy, and possibly X-ray crystallography to elucidate its structure and properties.
Formula:C38H44N2O2
InChI:InChI=1/C38H44N2O2/c1-3-5-7-9-27-41-35-19-15-31(16-20-35)11-13-33-23-25-39-37(29-33)38-30-34(24-26-40-38)14-12-32-17-21-36(22-18-32)42-28-10-8-6-4-2/h11-26,29-30H,3-10,27-28H2,1-2H3/b13-11+,14-12+
Synonyms:- 2,2'-bipyridine, 4,4'-bis[(E)-2-[4-(hexyloxy)phenyl]ethenyl]-
- 4,4'-Bis{(E)-2-[4-(hexyloxy)phenyl]vinyl}-2,2'-bipyridine
- 4,4'-bis{(E)-2-[4-(hexyloxy)phenyl]ethenyl}-2,2'-bipyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
