CAS 84661-50-7

5-amino-3-methyl-1,2-oxazole-4-carboxylic acid

Description:

5-Amino-3-methyl-1,2-oxazole-4-carboxylic acid is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its polar nature and potential for hydrogen bonding. The presence of the methyl group at the 3-position of the oxazole ring influences its solubility and reactivity. Typically, compounds like this can exhibit biological activity, making them of interest in pharmaceutical and biochemical research. The molecular structure allows for various functional interactions, which can be explored in synthetic chemistry and drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 5-amino-3-methyl-1,2-oxazole-4-carboxylic acid represents a unique class of heterocyclic compounds with potential applications in various fields, including medicinal chemistry and agrochemicals.

Formula: C₅H₆N₂O₃

InChI: InChI=1/C5H6N2O3/c1-2-3(5(8)9)4(6)10-7-2/h6H2,1H3,(H,8,9)

SMILES: Cc1c(c(N)on1)C(=O)O

Synonyms:

• 4-Isoxazolecarboxylic Acid, 5-Amino-3-Methyl-

4-Isoxazolecarboxylicacid, 5-amino-3-methyl-

CAS: 84661-50-7

Formula: C₅H₆N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 142.1127

Ref: IN-DA0050F1

5-Amino-3-methylisoxazole-4-carboxylic acid

CAS: 84661-50-7

5-Amino-3-methylisoxazole-4-carboxylic acid

Purity: 98%

Molecular weight: 142.11g/mol

Ref: 54-OR1042418

5-amino-3-methyl-4-isoxazolecarboxylic acid

CAS: 84661-50-7

Formula: C₅H₆N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 142.114

Ref: 10-F310855