CAS 84666-30-8
:2-(tributylstannanyl)prop-2-en-1-ol
Description:
2-(Tributylstannanyl)prop-2-en-1-ol, with the CAS number 84666-30-8, is an organotin compound characterized by the presence of a tributylstannyl group attached to a prop-2-en-1-ol moiety. This compound typically exhibits a colorless to pale yellow appearance and is soluble in organic solvents due to its hydrophobic tributyl groups. The presence of the alkenyl group (prop-2-en-1-ol) suggests that it can participate in various chemical reactions, including polymerization and cross-coupling reactions, making it useful in organic synthesis and materials science. The tributylstannyl group imparts unique properties, such as increased stability and reactivity, which can be advantageous in certain applications, including catalysis and as a reagent in organic transformations. However, organotin compounds are subject to environmental regulations due to their potential toxicity and bioaccumulation, necessitating careful handling and disposal. Overall, 2-(tributylstannanyl)prop-2-en-1-ol is a versatile compound with significant implications in both industrial and research settings.
Formula:C15H32OSn
InChI:InChI=1/3C4H9.C3H5O.Sn/c3*1-3-4-2;1-2-3-4;/h3*1,3-4H2,2H3;4H,1,3H2;/rC15H32OSn/c1-5-8-11-17(12-9-6-2,13-10-7-3)15(4)14-16/h16H,4-14H2,1-3H3
SMILES:CCCC[Sn](CCCC)(CCCC)C(=C)CO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Tributyltin-allyl-1-ol
CAS:Controlled Product2-Tributyltin-allyl-1-ol is a research chemical that has shown potential in various areas of study. It has been found to interact with epidermal growth factor (EGF) and may have implications in the development of new therapies targeting EGF receptors. Additionally, 2-Tributyltin-allyl-1-ol has been studied for its potential interactions with drugs such as afatinib and paroxetine, indicating its possible role in drug metabolism and pharmacokinetics.
Formula:C15H32OSnPurity:Min. 95%Color and Shape:Colorless Clear LiquidMolecular weight:347.12 g/mol2-Tributyltin-allyl-1-ol
CAS:Controlled ProductApplications 2-Tributyltin-allyl-1-ol (cas# 84666-30-8) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C15H32OSnColor and Shape:NeatMolecular weight:347.12

