CymitQuimica logo

CAS 84670-96-2

:

4-(Hexadecylamino)benzylamine

Description:
4-(Hexadecylamino)benzylamine, with the CAS number 84670-96-2, is an organic compound characterized by its long-chain alkyl amine structure. This substance features a hexadecyl group, which is a 16-carbon saturated alkyl chain, attached to a benzylamine moiety. The presence of the long hydrophobic hexadecyl chain imparts significant lipophilicity, making the compound soluble in organic solvents while exhibiting limited solubility in water. This amphiphilic nature allows it to interact with both hydrophobic and hydrophilic environments, which can be advantageous in various applications, including surfactants, emulsifiers, and potential drug delivery systems. The amine functional group contributes basic properties, allowing for protonation under acidic conditions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its stability and reactivity can be influenced by the surrounding environment, including pH and temperature. Overall, 4-(Hexadecylamino)benzylamine is a versatile compound with potential applications in various fields due to its unique structural characteristics.
Formula:C23H42N2
InChI:InChI=1/C23H42N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-25-23-18-16-22(21-24)17-19-23/h16-19,25H,2-15,20-21,24H2,1H3
SMILES:CCCCCCCCCCCCCCCCNc1ccc(cc1)CN
Synonyms:
  • 4-(Aminomethyl)-N-hexadecylaniline
  • Benzenemethanamine, 4-(Hexadecylamino)-
  • 4-(HEXADECYLAMINO)BENZYLAMINE, 95
  • 4-(Hexadecylamino)benzylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.