CAS 84676-48-2

ala-leu-ala-leu

Description:

The chemical substance known as "ala-leu-ala-leu," with the CAS number 84676-48-2, is a peptide composed of alternating alanine (Ala) and leucine (Leu) amino acids. This structure suggests that it may exhibit properties typical of peptides, such as the ability to form secondary structures like alpha-helices or beta-sheets, depending on the specific sequence and environmental conditions. Peptides like ala-leu-ala-leu can play significant roles in biological systems, including acting as signaling molecules or influencing protein folding and stability. The hydrophobic nature of leucine, combined with the more neutral character of alanine, may contribute to the peptide's overall hydrophobicity, potentially affecting its solubility and interaction with other biomolecules. Additionally, the sequence may influence its biological activity, making it of interest in fields such as biochemistry and pharmacology. Understanding the characteristics of such peptides can provide insights into their potential applications in drug development and therapeutic interventions.

Formula: C₁₈H₃₄N₄O₅

InChI: InChI=1/C18H34N4O5/c1-9(2)7-13(21-15(23)11(5)19)17(25)20-12(6)16(24)22-14(18(26)27)8-10(3)4/h9-14H,7-8,19H2,1-6H3,(H,20,25)(H,21,23)(H,22,24)(H,26,27)/t11-,12-,13-,14-/m0/s1

SMILES: CC(C)C[C@@H](C(=N[C@@H](C)C(=N[C@@H](CC(C)C)C(=O)O)O)O)N=C([C@H](C)N)O

Synonyms:

• Alanyl-leucyl-alanyl-leucine
• Alal
• L-Leucine, N-(N-(N-L-alanyl-L-leucyl)-L-alanyl)-
• L-alanyl-L-leucyl-L-alanyl-L-leucine