CAS 84681-79-8

2-(2-Hydroxyethyl)-1-piperidinecarboxaldehyde

Description:

2-(2-Hydroxyethyl)-1-piperidinecarboxaldehyde, with the CAS number 84681-79-8, is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxaldehyde functional group (-CHO) and a hydroxyethyl substituent, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of both the hydroxy and aldehyde groups allows for hydrogen bonding, which can influence its solubility in polar solvents like water and alcohols. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its reactivity can be harnessed in various chemical reactions, including condensation and oxidation processes. Safety data should be consulted for handling, as aldehydes can be irritants and may pose health risks. Overall, 2-(2-Hydroxyethyl)-1-piperidinecarboxaldehyde is a versatile compound with potential applications in various fields of chemistry.

Formula: C₈H₁₅NO₂

InChI: InChI=1S/C8H15NO2/c10-6-4-8-3-1-2-5-9(8)7-11/h7-8,10H,1-6H2

InChI key: InChIKey=UDCBJPFHVLCUHM-UHFFFAOYSA-N

SMILES: C(CO)C1N(C=O)CCCC1

Synonyms:

• 2-(2-Hydroxyethyl)-1-piperidinecarboxaldehyde
• 2-(2-Hydroxyethyl)piperidine-1-carbaldehyde
• 1-Piperidinecarboxaldehyde, 2-(2-hydroxyethyl)-