CAS 84682-15-5
:3-(2-Propen-1-yl)-2-(2-propen-1-yloxy)benzaldehyde
Description:
3-(2-Propen-1-yl)-2-(2-propen-1-yloxy)benzaldehyde, with the CAS number 84682-15-5, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features two propenyl groups attached to the benzene ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. The propenyl substituents enhance its potential for polymerization and other reactions typical of alkenes. This compound may exhibit properties such as volatility and solubility in organic solvents, making it useful in the synthesis of more complex organic molecules or as an intermediate in the production of fragrances and flavoring agents. Additionally, its structural characteristics suggest potential applications in materials science and medicinal chemistry, although specific biological activities would require further investigation. Overall, 3-(2-Propen-1-yl)-2-(2-propen-1-yloxy)benzaldehyde is a versatile compound with significant implications in various fields of chemistry.
Formula:C13H14O2
InChI:InChI=1S/C13H14O2/c1-3-6-11-7-5-8-12(10-14)13(11)15-9-4-2/h3-5,7-8,10H,1-2,6,9H2
InChI key:InChIKey=YIZHWEKWDRJEKT-UHFFFAOYSA-N
SMILES:O(CC=C)C1=C(CC=C)C=CC=C1C=O
Synonyms:- Benzaldehyde, 3-(2-propen-1-yl)-2-(2-propen-1-yloxy)-
- Benzaldehyde, 3-(2-propenyl)-2-(2-propenyloxy)-
- 3-(2-Propen-1-yl)-2-(2-propen-1-yloxy)benzaldehyde
- 2-Allyloxy-3-allylbenzaldehyde
- 3-Allyl-2-(allyloxy)benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
