CAS 84682-23-5
:2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolane-4-methanol
Description:
2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolane-4-methanol, with the CAS number 84682-23-5, is a synthetic organic compound characterized by its complex structure, which includes a dioxolane ring, a dichlorophenyl group, and an imidazolylmethyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the dichlorophenyl group may contribute to its lipophilicity, while the dioxolane and imidazole components can influence its reactivity and interaction with biological targets. The compound may also display specific functional characteristics, such as the ability to form hydrogen bonds due to the hydroxymethyl group, which can enhance its interactions in biological systems. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its pharmacological properties and safety profile would be necessary to fully understand its utility.
Formula:C14H14Cl2N2O3
InChI:InChI=1S/C14H14Cl2N2O3/c15-10-1-2-12(13(16)5-10)14(8-18-4-3-17-9-18)20-7-11(6-19)21-14/h1-5,9,11,19H,6-8H2
InChI key:InChIKey=VJZJGRMLFMJRGG-UHFFFAOYSA-N
SMILES:C(C1(OC(CO)CO1)C2=C(Cl)C=C(Cl)C=C2)N3C=CN=C3
Synonyms:- 1,3-Dioxolane-4-methanol, 2-(2,4-dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-
- [2-(2,4-dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methanol
- 2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolane-4-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
