CAS 84687-42-3
:Astragaloside III
Description:
Astragaloside III is a saponin compound primarily derived from the root of Astragalus membranaceus, a plant commonly used in traditional medicine. It is known for its potential pharmacological properties, including immunomodulatory, anti-inflammatory, and antioxidant effects. The chemical structure of Astragaloside III features a glycoside moiety, which contributes to its biological activity. This compound is typically characterized by its solubility in water and organic solvents, although its solubility can vary depending on the specific formulation. Astragaloside III has garnered interest in research for its potential therapeutic applications, particularly in enhancing immune function and protecting against oxidative stress. Additionally, studies have suggested that it may have cardioprotective and neuroprotective effects. As with many natural compounds, the efficacy and safety of Astragaloside III can depend on dosage, formulation, and individual patient factors, necessitating further research to fully understand its mechanisms and potential benefits in clinical settings.
Formula:C41H68O14
InChI:InChI=1S/C41H68O14/c1-35(2)24(53-34-30(26(46)21(45)17-51-34)54-33-29(49)28(48)27(47)22(16-42)52-33)9-11-41-18-40(41)13-12-37(5)32(39(7)10-8-25(55-39)36(3,4)50)20(44)15-38(37,6)23(40)14-19(43)31(35)41/h19-34,42-50H,8-18H2,1-7H3/t19-,20-,21+,22+,23-,24-,25-,26-,27+,28-,29+,30+,31-,32-,33-,34-,37+,38-,39+,40-,41+/m0/s1
InChI key:InChIKey=FVFSMBDVZVUETN-BQAOMNQWSA-N
SMILES:C[C@]12[C@]3([C@]4([C@]5(C4)[C@@]([C@@H](O)C3)(C(C)(C)[C@@H](O[C@H]6[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@@H](O)[C@H](O)CO6)CC5)[H])CC[C@]1(C)[C@]([C@@H](O)C2)([C@]8(C)O[C@H]([C@](C)(C)O)CC8)[H])[H]
Synonyms:- (3beta,6alpha,9beta,16beta,20R,24S)-6,16,25-Trihydroxy-20,24-epoxy-9,19-cyclolanostan-3-yl 2-O-beta-D-glucopyranosyl-beta-D-xylopyranoside
- (3β,6α,16β,20R,24S)-20,24-Epoxy-6,16,25-trihydroxy-9,19-cyclolanostan-3-yl 2-O-β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-β-<smallcap>D</span>-xylopyranoside
- beta-D-xylopyranoside, (3beta,6alpha,9beta,16beta,20R,24S)-20,24-epoxy-6,16,25-trihydroxy-9,19-cyclolanostan-3-yl 2-O-beta-D-glucopyranosyl-
- β-<span class="text-smallcaps">D</smallcap>-Xylopyranoside, (3β,6α,16β,20R,24S)-20,24-epoxy-6,16,25-trihydroxy-9,19-cyclolanostan-3-yl 2-O-β-<smallcap>D</span>-glucopyranosyl-
- β-D-Xylopyranoside, (3β,6α,16β,20R,24S)-20,24-epoxy-6,16,25-trihydroxy-9,19-cyclolanostan-3-yl 2-O-β-D-glucopyranosyl-
- Astragaloside III
- (3β,6α,16β,20R,24S)-20,24-Epoxy-6,16,25-trihydroxy-9,19-cyclolanostan-3-yl 2-O-β-D-glucopyranosyl-β-D-xylopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Astragaloside III
CAS:Formula:C16H18Br2ClN3O3Purity:98.0%Color and Shape:SolidMolecular weight:495.5934Astragaloside III
CAS:Astragaloside III can effectively reduce cancer cell survival in vitro and inhibit the tumor growth in vivo, the potential mechanism is the induction of cell apoptosis signaling pathways, suggests that it provides a new therapeutic tool to treat breast cancer.Formula:C41H68O14Purity:95%~99%Color and Shape:PowderMolecular weight:784.981Astragaloside III
CAS:Astragaloside III: Cardioprotective, boosts cognition, prevents cardio-cerebral diseases, antioxidant.Formula:C41H68O14Purity:99.69% - 99.90%Color and Shape:SolidMolecular weight:784.97Ref: TM-T5S0833
1mg50.00€2mg71.00€5mg105.00€1mL*10mM (DMSO)165.00€10mg178.00€25mg313.00€50mg464.00€100mg660.00€Astragaloside iii
CAS:Natural glycosideFormula:C41H68O14Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:784.99Astragaloside III
CAS:Astragaloside III is a bioactive compound that is classified as a cycloartane-type triterpene glycoside. This compound is derived from the roots of the plant Astragalus membranaceus, a traditional medicinal plant widely used in Chinese medicine. The mode of action of astragaloside III involves modulation of various signaling pathways, including the activation of the telomerase enzyme and modulation of the immune response. It exhibits antioxidant, anti-inflammatory, and anti-aging properties by protecting cellular components from oxidative damage and enhancing cellular repair mechanisms.
Formula:C41H68O14Purity:Min. 95%Color and Shape:PowderMolecular weight:784.97 g/mol






