CAS 84689-20-3
:2-[Cyano(2,3-dichlorophenyl)methylene]hydrazinecarboximidamide
Description:
2-[Cyano(2,3-dichlorophenyl)methylene]hydrazinecarboximidamide, with the CAS number 84689-20-3, is a chemical compound characterized by its complex structure, which includes a hydrazine derivative and a cyano group attached to a dichlorophenyl moiety. This compound typically exhibits properties associated with both hydrazine and cyano functional groups, such as potential reactivity in nucleophilic addition reactions and the ability to form hydrogen bonds due to the presence of the amide functionality. It may also display biological activity, making it of interest in pharmaceutical research. The presence of the dichlorophenyl group suggests that it may have specific electronic and steric properties, influencing its reactivity and interactions with other molecules. Additionally, the compound's stability, solubility, and behavior under various conditions (such as pH and temperature) would be essential for its practical applications. As with many chemical substances, safety data and handling precautions are crucial due to potential toxicity or reactivity.
Formula:C9H7Cl2N5
InChI:InChI=1S/C9H7Cl2N5/c10-6-3-1-2-5(8(6)11)7(4-12)15-16-9(13)14/h1-3H,(H4,13,14,16)
InChI key:InChIKey=BXDSJOGMJUKSAE-UHFFFAOYSA-N
SMILES:C(=NNC(=N)N)(C#N)C1=C(Cl)C(Cl)=CC=C1
Synonyms:- (2,3-Dichlorophenyl)(guanidinylimino)acetonitrile
- (2,3-Dichlorophenyl)Guanidylimino Acetonitrile
- 2-[Cyano(2,3-Dichlorophenyl)Methylene]-Hydrazine Carboximidamide
- 2-[Cyano(2,3-dichlorophenyl)methylene]hydrazinecarboximidamide
- Hydrazinecarboximidamide, 2-[cyano(2,3-dichlorophenyl)methylene]-
- N''-[(1Z)-cyano(2,3-dichlorophenyl)methylidene]carbonohydrazonic diamide
- 2-(2,3-Dichlorophenyl)-2-guanidinyliminoacetonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Lamotrigine EP Impurity B and Lamotrigine EP Impurity C
CAS:Formula:C9H7Cl2N5Color and Shape:Yellow SolidMolecular weight:256.092-(2,3-Dichlorphenyl)-2-(guanidinylimino)acetonitrile
CAS:Controlled ProductFormula:C9H7Cl2N5Color and Shape:Light YellowMolecular weight:256.092-(2,3-Dichlorophenyl)-2-guanidinyliminoacetonitrile
CAS:2-(2,3-Dichlorophenyl)-2-guanidinyliminoacetonitrile (2,3-DCPP) is a high quality reagent that is used in the preparation of complex compounds. It is also an intermediate in the synthesis of fine chemicals and useful scaffold and building block for research chemical. 2,3-DCPP has been shown to react with a variety of functional groups including amines, alcohols, thiols, carboxylic acids, organometallic reagents and many others. It is also a versatile building block for the synthesis of chemical substances such as pharmaceuticals, agrochemicals or dyes.Formula:C9H7Cl2N5Purity:Min. 95%Color and Shape:White PowderMolecular weight:256.09 g/mol



