CAS 84692-91-1: Arglabin
Description:Arglabin, with the CAS number 84692-91-1, is a natural compound derived from the plant species *Artemisia argyi*, commonly known as mugwort. This substance is characterized by its complex chemical structure, which includes multiple functional groups that contribute to its biological activity. Arglabin has been studied for its potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer effects. Its mechanism of action may involve the modulation of various signaling pathways and the inhibition of specific enzymes. Additionally, Arglabin exhibits low toxicity, making it a candidate for further research in therapeutic applications. The compound is typically isolated through extraction methods and may be analyzed using techniques such as chromatography and spectroscopy to confirm its purity and identity. As research continues, the full range of Arglabin's biological activities and potential uses in medicine and health supplements is being explored, highlighting its significance in natural product chemistry and pharmacognosy.
Formula:C15H18O3
InChI:InChI=1S/C15H18O3/c1-8-4-7-15-11(8)12-10(9(2)13(16)17-12)5-6-14(15,3)18-15/h4,10-12H,2,5-7H2,1,3H3/t10-,11+,12-,14-,15+/m0/s1
InChI key:InChIKey=UVJYAKBJSGRTHA-CUZKYEQNSA-N
SMILES:O=C1OC2C(C1=C)CCC3(OC43CC=C(C)C24)C
- Synonyms:
- (3aR,4aS,6aS,9aS,9bR)-5,6,6a,7,9a,9b-Hexahydro-1,4a-dimethyl-7-methylene-3H-oxireno[8,8a]azuleno[4,5-b]furan-8(4aH)-one
- (3aS,4aR,6aS,9aS,9bR)-1,4a-Dimethyl-7-methylene-5,6,6a,7,9a,9b-hexahydro-3H-oxireno[8,8a]azuleno[4,5-b]furan-8(4aH)-one
- 3H-Oxireno[8,8a]azuleno[4,5-b]furan-8(4aH)-one, 5,6,6a,7,9a,9b-hexahydro-1,4a-dimethyl-7-methylene-, (3aR,4aS,6aS,9aS,9bR)-
- 3H-Oxireno[8,8a]azuleno[4,5-b]furan-8(4aH)-one, 5,6,6a,7,9a,9b-hexahydro-1,4a-dimethyl-7-methylene-, [4aS-(3aS*,4aα,6aα,9aβ,9bα)]-
- 3H-oxireno[8,8a]azuleno[4,5-b]furan-8(4aH)-one, 5,6,6a,7,9a,9b-hexahydro-1,4a-dimethyl-7-methylene-, (3aS,4aR,6aS,9aS,9bR)-
- Arglabin
- Arglabine
