
CAS 84696-63-9
:2,16-Dimethyl-3,6,9,12,15-pentaoxaheptadecane
Description:
2,16-Dimethyl-3,6,9,12,15-pentaoxaheptadecane, with the CAS number 84696-63-9, is a synthetic organic compound characterized by its long carbon chain and multiple ether linkages. This molecule features a heptadecane backbone, which consists of 17 carbon atoms, and is substituted with five ether functional groups (-O-) at specific positions along the chain. The presence of methyl groups at the 2 and 16 positions contributes to its structural complexity and may influence its physical properties, such as solubility and boiling point. Generally, compounds with multiple ether linkages exhibit lower volatility and higher thermal stability compared to their alkane counterparts. Additionally, the presence of oxygen in the structure can enhance solubility in polar solvents. This compound may find applications in various fields, including materials science and pharmaceuticals, due to its unique properties. However, specific data on its reactivity, toxicity, and practical applications would require further investigation and analysis.
Formula:C14H30O5
InChI:InChI=1S/C14H30O5/c1-13(2)18-11-9-16-7-5-15-6-8-17-10-12-19-14(3)4/h13-14H,5-12H2,1-4H3
InChI key:InChIKey=OUNJLSKZDGVRNU-UHFFFAOYSA-N
SMILES:C(OC(C)C)COCCOCCOCCOC(C)C
Synonyms:- Tetraethylene glycol diisopropyl ether
- 2,16-Dimethyl-3,6,9,12,15-pentaoxaheptadecane
- 3,6,9,12,15-Pentaoxaheptadecane, 2,16-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,6,9,12,15-Pentaoxaheptadecane,2,16-dimethyl-
CAS:Formula:C14H30O5Molecular weight:278.38500000000005
