CymitQuimica logo

CAS 84696-64-0

:

2,13-Dimethyl-3,6,9,12-tetraoxatetradecane

Description:
2,13-Dimethyl-3,6,9,12-tetraoxatetradecane is a synthetic organic compound characterized by its unique structure, which includes a long carbon chain with multiple ether functional groups. The presence of four ether linkages contributes to its potential solubility in polar solvents and may influence its physical properties, such as melting and boiling points. The dimethyl substitutions at the 2 and 13 positions introduce branching, which can affect the compound's steric hindrance and overall reactivity. This compound is likely to exhibit low volatility and may have applications in fields such as materials science or as a surfactant due to its amphiphilic nature. Additionally, the presence of multiple oxygen atoms in the structure can enhance its compatibility with various chemical environments. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or literature reviews. Overall, 2,13-Dimethyl-3,6,9,12-tetraoxatetradecane represents a class of compounds that may have diverse applications based on their unique chemical properties.
Formula:C12H26O4
InChI:InChI=1S/C12H26O4/c1-11(2)15-9-7-13-5-6-14-8-10-16-12(3)4/h11-12H,5-10H2,1-4H3
InChI key:InChIKey=AHTTUKMNYVZLFF-UHFFFAOYSA-N
SMILES:C(OC(C)C)COCCOCCOC(C)C
Synonyms:
  • 3,6,9,12-Tetraoxatetradecane, 2,13-dimethyl-
  • 2,13-Dimethyl-3,6,9,12-tetraoxatetradecane
  • Triethylene glycol diisopropyl ether
  • 2-[2-[2-(2-Propan-2-yloxyethoxy)ethoxy]ethoxy]propane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.