CAS 847063-13-2
:1-[[2-(4-Chlorophenyl)ethyl]amino]-2-hydroxypropane
Description:
1-[[2-(4-Chlorophenyl)ethyl]amino]-2-hydroxypropane, identified by its CAS number 847063-13-2, is a chemical compound characterized by its structural features that include a hydroxy group, an ethyl chain, and a chlorophenyl moiety. This compound typically exhibits properties associated with amines and alcohols, such as potential solubility in polar solvents due to the presence of the hydroxy group. The chlorophenyl group may impart specific electronic characteristics, influencing the compound's reactivity and interaction with biological systems. The presence of the amino group suggests potential basicity, allowing for interactions with acids and other electrophiles. Additionally, the compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests that it could participate in hydrogen bonding, affecting its physical properties like boiling and melting points. Overall, this compound's unique combination of functional groups contributes to its potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C11H16ClNO
InChI:InChI=1/C11H16ClNO/c1-9(14)8-13-7-6-10-2-4-11(12)5-3-10/h2-5,9,13-14H,6-8H2,1H3
SMILES:CC(CNCCc1ccc(cc1)Cl)O
Synonyms:- 1-{[2-(4-Chlorophenyl)ethyl]amino}-2-propanol
- 1-{[2-(4-Chlorophenyl)ethyl]amino}propan-2-ol
- 1-{[2-(4-Chlorphenyl)ethyl]amino}propan-2-ol
- 2-Propanol, 1-[[2-(4-Chlorophenyl)Ethyl]Amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-((4-Chlorophenethyl)amino)propan-2-ol
CAS:Controlled ProductFormula:C11H16ClNOColor and Shape:NeatMolecular weight:213.704

