CAS 84712-09-4
:4,6-Dibromo-1,3-dihydro-2H-benzimidazol-2-one
Description:
4,6-Dibromo-1,3-dihydro-2H-benzimidazol-2-one is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with bromine atoms at the 4 and 6 positions. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the bromine substituents can enhance the compound's reactivity and influence its interaction with biological targets. It is soluble in organic solvents, which can facilitate its use in various chemical reactions and formulations. The compound's molecular structure contributes to its stability and reactivity, making it of interest in synthetic organic chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit toxicity and environmental concerns. Overall, 4,6-Dibromo-1,3-dihydro-2H-benzimidazol-2-one represents a significant compound in the realm of chemical research and development.
Formula:C7H4Br2N2O
InChI:InChI=1S/C7H4Br2N2O/c8-3-1-4(9)6-5(2-3)10-7(12)11-6/h1-2H,(H2,10,11,12)
InChI key:InChIKey=XUJVCNQSWGHIIG-UHFFFAOYSA-N
SMILES:BrC1=C2C(NC(=O)N2)=CC(Br)=C1
Synonyms:- 2H-Benzimidazol-2-one, 4,6-dibromo-1,3-dihydro-
- 4,6-Dibromo-1,3-dihydro-2H-benzimidazol-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.