CymitQuimica logo

CAS 84712-72-1

:

6-Chloro-N2-cyclopentyl-1,3,5-triazine-2,4-diamine

Description:
6-Chloro-N2-cyclopentyl-1,3,5-triazine-2,4-diamine, with the CAS number 84712-72-1, is a chemical compound that belongs to the class of triazines, which are characterized by a six-membered ring containing three nitrogen atoms. This compound features a chloro substituent at the 6-position and a cyclopentyl group at the N2 position, contributing to its unique properties. It is primarily recognized for its potential applications in agricultural chemistry, particularly as a herbicide or a plant growth regulator. The presence of the triazine ring structure often imparts stability and resistance to degradation, making it effective in various environmental conditions. Additionally, the amino groups in the structure can participate in hydrogen bonding and other interactions, influencing its solubility and reactivity. Overall, 6-Chloro-N2-cyclopentyl-1,3,5-triazine-2,4-diamine is notable for its specific functional groups and structural characteristics that define its chemical behavior and applications.
Formula:C8H12ClN5
InChI:InChI=1S/C8H12ClN5/c9-6-12-7(10)14-8(13-6)11-5-3-1-2-4-5/h5H,1-4H2,(H3,10,11,12,13,14)
InChI key:InChIKey=AMEQGMVFTOUTHW-UHFFFAOYSA-N
SMILES:N(C=1N=C(Cl)N=C(N)N1)C2CCCC2
Synonyms:
  • 1,3,5-Triazine-2,4-diamine, 6-chloro-N-cyclopentyl-
  • 6-Chloro-N2-cyclopentyl-1,3,5-triazine-2,4-diamine
  • 1,3,5-Triazine-2,4-diamine, 6-chloro-N2-cyclopentyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.