CAS 847155-18-4

5-Methyl-1,3,4-thiadiazole-2-ethanol

Description:

5-Methyl-1,3,4-thiadiazole-2-ethanol is a heterocyclic compound characterized by the presence of a thiadiazole ring, which contains sulfur and nitrogen atoms. This compound features a methyl group at the 5-position and a hydroxyl group (-OH) at the 2-position of the thiadiazole ring, contributing to its unique chemical properties. It is typically a colorless to light yellow liquid or solid, depending on its form and purity. The presence of the hydroxyl group suggests that it may exhibit moderate solubility in polar solvents, such as water and alcohols, while the thiadiazole ring may impart some degree of biological activity or reactivity. This compound may be of interest in various fields, including pharmaceuticals, agrochemicals, and materials science, due to its potential applications in drug development or as a building block for more complex molecules. As with many thiadiazole derivatives, it may also exhibit specific interactions with biological targets, making it a subject of research in medicinal chemistry.

Formula: C₅H₈N₂OS

InChI: InChI=1S/C5H8N2OS/c1-4-6-7-5(9-4)2-3-8/h8H,2-3H2,1H3

InChI key: InChIKey=ALIWDKZXCKEGDH-UHFFFAOYSA-N

SMILES: C(CO)C=1SC(C)=NN1

Synonyms:

• 1,3,4-Thiadiazole-2-ethanol, 5-methyl-
• 2-(2-Hydroxyethyl)-5-methyl-1,3,4-thiadiazole
• 2-(5-Methyl-1,3,4-thiadiazol-2-yl)ethan-1-ol
• 5-Methyl-1,3,4-thiadiazole-2-ethanol