CymitQuimica logo

CAS 847171-51-1

:

2-chloro-5-(3,4-dihydroquinolin-1(2H)-ylsulfonyl)aniline

Description:
2-Chloro-5-(3,4-dihydroquinolin-1(2H)-ylsulfonyl)aniline is a chemical compound characterized by its complex structure, which includes a chloro group, an aniline moiety, and a sulfonyl group attached to a dihydroquinoline ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the sulfonyl group may impart increased polarity, influencing its reactivity and interactions with biological targets. Additionally, the chloro substituent can affect the compound's electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. This compound may be of interest in medicinal chemistry, particularly for its potential biological activities, which could include antimicrobial or anticancer properties. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C15H15ClN2O2S
InChI:InChI=1/C15H15ClN2O2S/c16-13-8-7-12(10-14(13)17)21(19,20)18-9-3-5-11-4-1-2-6-15(11)18/h1-2,4,6-8,10H,3,5,9,17H2
SMILES:c1ccc2c(c1)CCCN2S(=O)(=O)c1ccc(c(c1)N)Cl
Synonyms:
  • 2-Chloro-5-(3,4-dihydroquinolin-1(2H)-ylsulfonyl)aniline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.