
CAS 847173-30-2
:2,3,4,5-Tetrahydro-7,8-dimethoxy-1H-1-benzazepine
Description:
2,3,4,5-Tetrahydro-7,8-dimethoxy-1H-1-benzazepine is a chemical compound characterized by its unique bicyclic structure, which includes a benzene ring fused to a seven-membered azepine ring. This compound features two methoxy groups (-OCH3) at the 7 and 8 positions of the benzazepine framework, contributing to its chemical reactivity and potential biological activity. The tetrahydro configuration indicates that the compound has four hydrogen atoms added to the azepine ring, resulting in a saturated structure that can influence its solubility and stability. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of methoxy groups can enhance lipophilicity, potentially affecting the compound's ability to cross biological membranes. As with many organic compounds, the specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which the compound is studied. Further research would be necessary to fully elucidate its properties and potential applications.
Formula:C12H17NO2
InChI:InChI=1S/C12H17NO2/c1-14-11-7-9-5-3-4-6-13-10(9)8-12(11)15-2/h7-8,13H,3-6H2,1-2H3
InChI key:InChIKey=WZVVSROLGHZUFU-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1OC)NCCCC2
Synonyms:- 2,3,4,5-Tetrahydro-7,8-dimethoxy-1H-1-benzazepine
- 1H-1-Benzazepine, 2,3,4,5-tetrahydro-7,8-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.