CAS 84719-33-5
:2,5-Pyridinediol
Description:
2,5-Pyridinediol, also known as 2,5-dihydroxypyridine, is an organic compound characterized by a pyridine ring with two hydroxyl (-OH) groups located at the 2 and 5 positions. This compound is typically a white to light yellow crystalline solid and is soluble in water due to the presence of hydroxyl groups, which enhance its polarity. It exhibits properties typical of diols, such as the ability to participate in hydrogen bonding, which can influence its reactivity and interactions with other substances. 2,5-Pyridinediol can act as a reducing agent and is of interest in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Its structure allows for potential coordination with metal ions, making it relevant in coordination chemistry. Additionally, it may exhibit biological activity, which warrants further investigation for potential therapeutic uses. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C5H5NO2
InChI:InChI=1S/C5H5NO2/c7-4-1-2-5(8)6-3-4/h1-3,7H,(H,6,8)
InChI key:InChIKey=CHGPEDOMXOLANF-UHFFFAOYSA-N
SMILES:OC=1C=CC(O)=NC1
Synonyms:- 2,5-Pyridinediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
