CAS 847227-37-6
:5-Butyl-2-chloropyrimidine
Description:
5-Butyl-2-chloropyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The presence of a butyl group at the 5 position and a chlorine atom at the 2 position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents, such as ethanol and dichloromethane, but has limited solubility in water due to its hydrophobic butyl group. 5-Butyl-2-chloropyrimidine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in the synthesis of pharmaceuticals and agrochemicals. Its reactivity is influenced by the electron-withdrawing nature of the chlorine atom, which can enhance the electrophilicity of the pyrimidine ring. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested.
Formula:C8H11ClN2
InChI:InChI=1/C8H11ClN2/c1-2-3-4-7-5-10-8(9)11-6-7/h5-6H,2-4H2,1H3
SMILES:CCCCc1cnc(Cl)nc1
Synonyms:- 5-n-Butyl-2-chloropyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
