CAS 847239-17-2
:3-[4-Hydroxy-3-[5,6,7,8-Tetrahydro-5,5,8,8-Tetramethyl-3-(Pentyloxy)-2-Naphthalenyl]Phenyl]-2-Propenoicacid
Description:
3-[4-Hydroxy-3-[5,6,7,8-Tetrahydro-5,5,8,8-Tetramethyl-3-(Pentyloxy)-2-Naphthalenyl]Phenyl]-2-Propenoic acid, with the CAS number 847239-17-2, is a complex organic compound characterized by its unique structural features, including multiple aromatic rings and a propenoic acid functional group. This compound exhibits properties typical of phenolic compounds, such as potential antioxidant activity due to the presence of hydroxyl groups. The tetrahydro and tetramethyl groups contribute to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. The pentyloxy substituent enhances its lipophilicity, which may affect its bioavailability and pharmacokinetics. Additionally, the presence of the propenoic acid moiety suggests potential reactivity in various chemical reactions, including polymerization or esterification. Overall, this compound's intricate structure may confer specific biological activities, making it of interest in medicinal chemistry and materials science. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C28H36O4
InChI:InChI=1S/C28H36O4/c1-6-7-8-15-32-25-18-23-22(27(2,3)13-14-28(23,4)5)17-21(25)20-16-19(9-11-24(20)29)10-12-26(30)31/h9-12,16-18,29H,6-8,13-15H2,1-5H3,(H,30,31)/b12-10+
InChI key:APJSHECCIRQQDV-ZRDIBKRKSA-N
SMILES:CCCCCOC1=CC2=C(C=C1C3=C(C=CC(=C3)/C=C/C(=O)O)O)C(CCC2(C)C)(C)C
Synonyms:- 3-[4-Hydroxy-3-(5,5,8,8-Tetramethyl-3-Pentoxy-6,7-Dihydronaphthalen-2-Yl)Phenyl]Prop-2-Enoic Acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
UVI 3003
CAS:UVI 3003Formula:C28H36O4Purity:98%Color and Shape:Solid-PowderMolecular weight:436.58303Ref: IN-DA008GQ3
1mg55.00€5mg125.00€10mg168.00€25mg284.00€50mg541.00€100mg673.00€250mg1,141.00€1g3,719.00€UVI 3003
CAS:3-(4-Hydroxy-3-(5,5,8,8-tetramethyl-3-(pentyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl)phenyl)acrylic acidFormula:C28H36O4Purity:98% (E)Molecular weight:436.58UVI 3003
CAS:UVI 3003 blocks retinoid X receptor (RXRα) in Xenopus/human Cos7 cells; IC50: 0.22/0.24 μM.Formula:C28H36O4Purity:99.82%Color and Shape:SolidMolecular weight:436.58Ref: TM-T17209
1mg34.00€2mg49.00€5mg71.00€1mL*10mM (DMSO)81.00€10mg113.00€25mg230.00€50mg385.00€100mg575.00€UVI 3003
CAS:UVI 3003 is a light stabilizer that functions as an ultraviolet (UV) absorber, primarily utilized in the protection of various materials from UV radiation. This product is synthesized from advanced chemical compounds designed to absorb UV light and prevent its transmission through the material. The mode of action involves converting UV radiation into harmless thermal energy, which is then dissipated, thereby protecting the underlying matrix from photodegradation.
Formula:C28H36O4Purity:Min. 95%Molecular weight:436.58 g/mol




