CAS 847375-16-0

N-[[4-[(4,10-Dihydro-1-methylpyrazolo[3,4-b][1,5]benzodiazepin-5(1H)-yl)carbonyl]-2-methylphenyl]methyl]-4-[(3,5-dihydroxyphenyl)methyl]-1-piperazinecarboxamide

Description:

The chemical substance N-[[4-[(4,10-Dihydro-1-methylpyrazolo[3,4-b][1,5]benzodiazepin-5(1H)-yl)carbonyl]-2-methylphenyl]methyl]-4-[(3,5-dihydroxyphenyl)methyl]-1-piperazinecarboxamide, with CAS number 847375-16-0, is a complex organic compound characterized by its multi-ring structure and various functional groups. It features a piperazine moiety, which is known for its role in pharmacological activity, particularly in the development of psychoactive drugs. The presence of a benzodiazepine derivative contributes to its potential biological effects, while the carbonyl and hydroxyl groups may enhance its solubility and reactivity. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its intricate structure suggests potential applications in treating neurological or psychiatric disorders, although detailed pharmacological data would be necessary to fully understand its efficacy and safety profile. As with many complex organic compounds, its synthesis and characterization would require advanced techniques in organic chemistry.

Formula: C₃₂H₃₅N₇O₄

InChI: InChI=1S/C32H35N7O4/c1-21-13-23(31(42)39-20-25-18-34-36(2)30(25)35-28-5-3-4-6-29(28)39)7-8-24(21)17-33-32(43)38-11-9-37(10-12-38)19-22-14-26(40)16-27(41)15-22/h3-8,13-16,18,35,40-41H,9-12,17,19-20H2,1-2H3,(H,33,43)

InChI key: InChIKey=HWPGRFRXZNLZEX-UHFFFAOYSA-N

SMILES: C(=O)(N1C=2C(NC3=C(C1)C=NN3C)=CC=CC2)C4=CC(C)=C(CNC(=O)N5CCN(CC6=CC(O)=CC(O)=C6)CC5)C=C4

Synonyms:

• 1-Piperazinecarboxamide, N-[[4-[(4,10-dihydro-1-methylpyrazolo[3,4-b][1,5]benzodiazepin-5(1H)-yl)carbonyl]-2-methylphenyl]methyl]-4-[(3,5-dihydroxyphenyl)methyl]-
• WAY 267464
• N-[[4-[(4,10-Dihydro-1-methylpyrazolo[3,4-b][1,5]benzodiazepin-5(1H)-yl)carbonyl]-2-methylphenyl]methyl]-4-[(3,5-dihydroxyphenyl)methyl]-1-piperazinecarboxamide
• WAY-267,464

WAY 267464 dihydrochloride

CAS: 847375-16-0

WAY 267464 dihydrochloride is a selective agonist used in neuroscience research, derived from synthetic sources to specifically target the neuropeptide Y receptor Y1. This compound operates by mimicking the natural ligand's action on the Y1 receptor, leading to specific receptor activation. This mechanism is significant in the modulation of various physiological processes related to neuropeptide Y, including appetite regulation, anxiety, and stress response.

Formula: C₃₂H₃₇Cl₂N₇O₄

Purity: Min. 95%

Molecular weight: 654.6 g/mol

Ref: 3D-XIB37516

WAY-267464

CAS: 847375-16-0

oxytocin receptor (OTR) agonist

Formula: C₃₂H₃₅N₇O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 581.66

Ref: TM-T23528