CAS 847375-46-6

(2S)-2-(3,5-Dihydroxyphenyl)-2,3-dihydro-7-hydroxy-4H-1-benzopyran-4-one

Description:

The chemical substance known as (2S)-2-(3,5-Dihydroxyphenyl)-2,3-dihydro-7-hydroxy-4H-1-benzopyran-4-one, with the CAS number 847375-46-6, is a flavonoid derivative characterized by its complex polyphenolic structure. This compound features a benzopyran core, which is typical of flavonoids, and includes multiple hydroxyl groups that contribute to its potential antioxidant properties. The presence of the 3,5-dihydroxyphenyl group enhances its reactivity and biological activity, making it of interest in various fields, including pharmacology and nutrition. Its stereochemistry, indicated by the (2S) configuration, suggests specific spatial arrangements that can influence its interaction with biological targets. This compound may exhibit various biological activities, such as anti-inflammatory, antimicrobial, or anticancer effects, although specific studies would be necessary to confirm these properties. Additionally, its solubility and stability can be influenced by the hydroxyl groups, which may affect its bioavailability and efficacy in therapeutic applications.

Formula: C₁₅H₁₂O₅

InChI: InChI=1S/C15H12O5/c16-9-1-2-12-13(19)7-14(20-15(12)6-9)8-3-10(17)5-11(18)4-8/h1-6,14,16-18H,7H2/t14-/m0/s1

InChI key: InChIKey=OVSYWZXDPOVKQU-AWEZNQCLSA-N

SMILES: O=C1C=2C(O[C@@H](C1)C3=CC(O)=CC(O)=C3)=CC(O)=CC2

Synonyms:

• (2S)-2-(3,5-Dihydroxyphenyl)-2,3-dihydro-7-hydroxy-4H-1-benzopyran-4-one
• 7,3′,5′-Trihydroxyflavanone
• 4H-1-Benzopyran-4-one, 2-(3,5-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-, (2S)-

7,3′,5′-Trihydroxyflavanone

CAS: 847375-46-6

7,3′,5′-Trihydroxyflavanone, a flavanoid derivative, promotes apoptotic cell death in MCF-7 cells by augmenting Bax expression.

Formula: C₁₅H₁₂O₅

Color and Shape: Solid

Molecular weight: 272.25

Ref: TM-T40940

7,3',5'-Trihydroxyflavanone

CAS: 847375-46-6

Formula: C₁₅H₁₂O₅

Purity: 95%~99%

Molecular weight: 272.256

Ref: BP-BP5118

7,3′,5′-Trihydroxyflavanone

CAS: 847375-46-6

7,3′,5′-Trihydroxyflavanone is a medicinal compound that has shown potential as an anticancer agent. This analog of flavanone has been found to induce apoptosis in cancer cells by inhibiting kinases and protein synthesis. It also exhibits inhibitory activity against tumor growth and has been shown to be effective against various types of cancers. 7,3′,5′-Trihydroxyflavanone has been used in Chinese traditional medicine for its anti-inflammatory properties and may have potential as a natural remedy for cancer treatment. Its unique chemical structure makes it a promising candidate for the development of kinase inhibitors and other therapeutic agents.

Formula: C₁₅H₁₂O₅

Purity: Min. 95%

Molecular weight: 272.25 g/mol

Ref: 3D-XIB37546