CAS 84744-28-5
:Calceolarioside A
Description:
Calceolarioside A, with the CAS number 84744-28-5, is a natural compound primarily derived from plants in the Calceolaria genus, known for their distinctive pouch-like flowers. This compound is classified as a phenolic glycoside, which typically features a phenolic moiety linked to a sugar unit. Calceolarioside A exhibits various biological activities, including antioxidant and anti-inflammatory properties, making it of interest in pharmacological research. Its structure contributes to its potential therapeutic effects, as phenolic compounds are often associated with health benefits due to their ability to scavenge free radicals. Additionally, Calceolarioside A may play a role in plant defense mechanisms, helping to protect against herbivores and pathogens. Research into this compound is ongoing, focusing on its mechanisms of action and potential applications in medicine and health. As with many natural products, the extraction and purification processes are crucial for studying its properties and efficacy in various biological contexts.
Formula:C23H26O11
InChI:InChI=1/C23H26O11/c24-11-18-22(34-19(29)6-3-12-1-4-14(25)16(27)9-12)20(30)21(31)23(33-18)32-8-7-13-2-5-15(26)17(28)10-13/h1-6,9-10,18,20-28,30-31H,7-8,11H2/b6-3+/t18-,20-,21-,22-,23-/m1/s1
InChI key:InChIKey=UHIGZYLCYRQESL-VJWFJHQPSA-N
SMILES:O(C(/C=C/C1=CC(O)=C(O)C=C1)=O)[C@@H]2[C@@H](CO)O[C@@H](OCCC3=CC(O)=C(O)C=C3)[C@H](O)[C@H]2O
Synonyms:- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl, 4-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
- Des(rhamnosyl)acteoside
- beta-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 4-O-[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]-
- Calceolarioside A
- De(rhamnosyl)verbascoside
- 2-(3,4-Dihydroxyphenyl)ethyl 4-O-[(E)-3-(3,4-dihydroxyphenyl)propenoyl]-β-D-glucopyranoside
- Desrhamnosyl acteoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Calceolarioside A
CAS:<p>Calceolarioside A is active against leishmaniasis, affects rabbit platelets via a calcium mechanism, and is a potent antioxidant.</p>Formula:C23H26O11Purity:98%Color and Shape:SolidMolecular weight:478.45Calceolarioside A
CAS:<p>Calceolarioside A is a phenylethanoid glycoside, which is a biologically active compound obtained from natural plant sources, specifically from species within the Calceolaria family. This compound exhibits significant antioxidant activity, primarily through its ability to scavenge free radicals and inhibit oxidative stress. The mode of action involves the modulation of oxidative pathways, offering protective effects against cellular damage.</p>Formula:C23H26O11Purity:Min. 95%Color and Shape:PowderMolecular weight:478.4 g/mol

