CymitQuimica logo

CAS 847448-33-3

:

Benzenemethanamine, 3,4-dichloro-α-ethyl-, hydrochloride (1:1)

Description:
Benzenemethanamine, 3,4-dichloro-α-ethyl-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine functional group and aromatic benzene ring. The presence of the 3,4-dichloro substituents on the benzene ring indicates that it has two chlorine atoms attached to the carbon atoms at positions 3 and 4, which can influence its reactivity and biological activity. The α-ethyl group suggests that there is an ethyl substituent attached to the carbon adjacent to the amine group, which can affect the compound's steric and electronic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it easier to handle in various applications. This compound may exhibit pharmacological properties, and its structure suggests potential uses in medicinal chemistry. However, specific biological activity, toxicity, and safety profiles would require further investigation through empirical studies and literature review.
Formula:C9H11Cl2N·ClH
InChI:InChI=1S/C9H11Cl2N.ClH/c1-2-9(12)6-3-4-7(10)8(11)5-6;/h3-5,9H,2,12H2,1H3;1H
InChI key:InChIKey=FEEGTQCAUBOZDI-UHFFFAOYSA-N
SMILES:C(CC)(N)C1=CC(Cl)=C(Cl)C=C1.Cl
Synonyms:
  • Benzenemethanamine, 3,4-dichloro-α-ethyl-, hydrochloride
  • Benzenemethanamine, 3,4-dichloro-α-ethyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.