CAS 84745-94-8
:Qingyangshengenin
Description:
Qingyangshengenin, with the CAS number 84745-94-8, is a chemical compound that belongs to the class of triterpenoids, which are naturally occurring compounds often found in various plants. This substance is characterized by its complex molecular structure, typically featuring multiple rings and functional groups that contribute to its biological activity. Qingyangshengenin has garnered interest in pharmacological research due to its potential therapeutic properties, including anti-inflammatory, antioxidant, and anticancer effects. Its mechanism of action may involve modulation of various signaling pathways and interactions with cellular targets. Additionally, the compound's solubility, stability, and bioavailability are important factors that influence its efficacy in biological systems. As with many natural products, the extraction and purification processes can affect the yield and quality of Qingyangshengenin, making it essential for researchers to optimize these methods for further studies. Overall, Qingyangshengenin represents a promising area of study within natural product chemistry and pharmacology.
Formula:C28H36O8
InChI:InChI=1S/C28H36O8/c1-16(29)26(33)12-13-28(35)25(26,3)22(36-23(32)17-4-6-19(30)7-5-17)15-21-24(2)10-9-20(31)14-18(24)8-11-27(21,28)34/h4-8,20-22,30-31,33-35H,9-15H2,1-3H3/t20-,21+,22+,24-,25+,26+,27-,28+/m0/s1
InChI key:InChIKey=IMRGSWAJVVVYOW-ZCARJHNXSA-N
SMILES:C[C@@]12[C@@](O)([C@@]3(O)[C@](C[C@H]1OC(=O)C4=CC=C(O)C=C4)([C@]5(C)C(=CC3)C[C@@H](O)CC5)[H])CC[C@]2(C(C)=O)O
Synonyms:- (3Beta,12Beta,14Beta,17Alpha)-17-(Acetyloxy)-3,8,14,17-Tetrahydroxyandrost-5-En-12-Yl 4-Hydroxybenzoate
- (3β,12β,14β,17α)-3,8,14,17-Tetrahydroxy-12-[(4-hydroxybenzoyl)oxy]pregn-5-en-20-one
- NSC 379666
- Pregn-5-en-20-one, 3,8,14,17-tetrahydroxy-12-[(4-hydroxybenzoyl)oxy]-, (3β,12β,14β,17α)-
- Qingyangshengenin
- Qingyanshengenin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cynanchagenin
CAS:Qingyangshengenin is a a glycoside from the roots of Cynanchum otophyllum.Formula:C28H36O8Purity:95%~99%Molecular weight:500.588Qingyangshengenin
CAS:Qingyangshengenin (Cynanchagenin) is a steroid used in the preparation of antiepileptic agents.Formula:C28H36O8Purity:99.62% - 99.89%Color and Shape:SolidMolecular weight:500.58Qingyangshengenin
CAS:Controlled ProductQingyangshengenin is a natural product that has been shown to inhibit the proliferation of human osteosarcoma cells and induce apoptosis in these cells. It is believed to exert its effects by suppressing the energy metabolism and inhibiting transcriptional regulation of pro-apoptotic proteins. Qingyangshengenin also has anti-microbial activity, which may be due to its ability to inhibit microbial growth through inhibition of bacterial transcription and translation. This natural product has also been shown to have anti-inflammatory properties, as it inhibits the production of inflammatory cytokines such as growth factor-β1 and tumor necrosis factor-α (TNF-α).
Purity:Min. 95%





