CAS 84748-20-9

N'-hydroxy-2H-chromene-3-carboximidamide

Description:

N'-hydroxy-2H-chromene-3-carboximidamide is a chemical compound characterized by its unique structural features, which include a chromene backbone and an imidamide functional group. This compound typically exhibits properties associated with both chromenes and imidamides, such as potential biological activity and the ability to participate in hydrogen bonding due to the presence of the hydroxyl and imidamide groups. The chromene structure contributes to its aromatic characteristics, which may influence its solubility and reactivity. Additionally, the presence of the hydroxyl group can enhance its interaction with biological targets, making it of interest in medicinal chemistry. The compound may also exhibit specific spectral properties, such as UV-Vis absorbance, due to its conjugated system. Overall, N'-hydroxy-2H-chromene-3-carboximidamide is a compound of interest for research in various fields, including organic synthesis and pharmacology, due to its potential applications and unique chemical properties.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1/C10H10N2O2/c11-10(12-13)8-5-7-3-1-2-4-9(7)14-6-8/h1-5,13H,6H2,(H2,11,12)

SMILES: c1ccc2c(c1)C=C(CO2)C(=N)NO